C18H21N3O5S — CID 9075807
ethyl N-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]carbamate (PubChem CID 9075807) has the molecular formula C18H21N3O5S and a molecular weight of 391.45 g/mol. Its IUPAC name is ethyl N-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 9075807 |
| Molecular Formula | C18H21N3O5S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | ethyl N-[(Z)-1-[4-[(4-methoxyphenyl)sulfamoyl]phenyl]ethylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C(/C)c1ccc(S(=O)(=O)Nc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H21N3O5S/c1-4-26-18(22)20-19-13(2)14-5-11-17(12-6-14)27(23,24)21-15-7-9-16(25-3)10-8-15/h5-12,21H,4H2,1-3H3,(H,20,22)/b19-13- |
| InChIKey | OTMGZHWGNGFXKQ-UYRXBGFRSA-N |
| XLogP | 2.97 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|