C11H14N2O3 — CID 2739255
ethyl N-[1-(4-hydroxyphenyl)ethylideneamino]carbamate (PubChem CID 2739255) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl N-[1-(4-hydroxyphenyl)ethylideneamino]carbamate.
| Compound Name | ethyl N-[1-(4-hydroxyphenyl)ethylideneamino]carbamate |
|---|---|
| PubChem CID | 2739255 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | ethyl N-[1-(4-hydroxyphenyl)ethylideneamino]carbamate |
| SMILES | CCOC(=O)NN=C(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N2O3/c1-3-16-11(15)13-12-8(2)9-4-6-10(14)7-5-9/h4-7,14H,3H2,1-2H3,(H,13,15) |
| InChIKey | CLJBVUUDSXMRPF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|