C16H25N2O5PS — CID 88711045
ethyl N-[1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]ethylideneamino]carbamate (PubChem CID 88711045) has the molecular formula C16H25N2O5PS and a molecular weight of 388.43 g/mol. Its IUPAC name is ethyl N-[1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]ethylideneamino]carbamate.
| Compound Name | ethyl N-[1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]ethylideneamino]carbamate |
|---|---|
| PubChem CID | 88711045 |
| Molecular Formula | C16H25N2O5PS |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | ethyl N-[1-[4-[ethoxy(propylsulfanyl)phosphoryl]oxyphenyl]ethylideneamino]carbamate |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(C(C)=NNC(=O)OCC)cc1 |
| InChI | InChI=1S/C16H25N2O5PS/c1-5-12-25-24(20,22-7-3)23-15-10-8-14(9-11-15)13(4)17-18-16(19)21-6-2/h8-11H,5-7,12H2,1-4H3,(H,18,19) |
| InChIKey | QNEXKJJVKPXTGD-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|