C19H23O4PS — CID 54471577
[4-[ethoxy(propylsulfanyl)phosphoryl]oxy-3-methylphenyl]-phenylmethanone (PubChem CID 54471577) has the molecular formula C19H23O4PS and a molecular weight of 378.43 g/mol. Its IUPAC name is [4-[ethoxy(propylsulfanyl)phosphoryl]oxy-3-methylphenyl]-phenylmethanone.
| Compound Name | [4-[ethoxy(propylsulfanyl)phosphoryl]oxy-3-methylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 54471577 |
| Molecular Formula | C19H23O4PS |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | [4-[ethoxy(propylsulfanyl)phosphoryl]oxy-3-methylphenyl]-phenylmethanone |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C19H23O4PS/c1-4-13-25-24(21,22-5-2)23-18-12-11-17(14-15(18)3)19(20)16-9-7-6-8-10-16/h6-12,14H,4-5,13H2,1-3H3 |
| InChIKey | XISRPAWMWPXTMU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|