C13H21O5PS2 — CID 12881481
1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-methoxy-4-methylsulfinylbenzene (PubChem CID 12881481) has the molecular formula C13H21O5PS2 and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-methoxy-4-methylsulfinylbenzene.
| Compound Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-methoxy-4-methylsulfinylbenzene |
|---|---|
| PubChem CID | 12881481 |
| Molecular Formula | C13H21O5PS2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-methoxy-4-methylsulfinylbenzene |
| SMILES | CCCSP(=O)(OCC)Oc1ccc(S(C)=O)cc1OC |
| InChI | InChI=1S/C13H21O5PS2/c1-5-9-20-19(14,17-6-2)18-12-8-7-11(21(4)15)10-13(12)16-3/h7-8,10H,5-6,9H2,1-4H3 |
| InChIKey | BTVRRTTYRKXHQO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|