C13H18F3O3PS2 — CID 13272083
1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-(2,2,2-trifluoroethylsulfanyl)benzene (PubChem CID 13272083) has the molecular formula C13H18F3O3PS2 and a molecular weight of 374.39 g/mol. Its IUPAC name is 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-(2,2,2-trifluoroethylsulfanyl)benzene.
| Compound Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-(2,2,2-trifluoroethylsulfanyl)benzene |
|---|---|
| PubChem CID | 13272083 |
| Molecular Formula | C13H18F3O3PS2 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | 1-[ethoxy(propylsulfanyl)phosphoryl]oxy-2-(2,2,2-trifluoroethylsulfanyl)benzene |
| SMILES | CCCSP(=O)(OCC)Oc1ccccc1SCC(F)(F)F |
| InChI | InChI=1S/C13H18F3O3PS2/c1-3-9-22-20(17,18-4-2)19-11-7-5-6-8-12(11)21-10-13(14,15)16/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | OOOJUTIJFFRGLF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|