About dimethyl (4-methylsulfanylphenyl) phosphate
dimethyl (4-methylsulfanylphenyl) phosphate (PubChem CID 18621) has the molecular formula C9H13O4PS
and a molecular weight of 248.24 g/mol. Its IUPAC name is dimethyl (4-methylsulfanylphenyl) phosphate.
Molecular Properties
| Compound Name | dimethyl (4-methylsulfanylphenyl) phosphate |
| PubChem CID | 18621 |
| Molecular Formula | C9H13O4PS |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | dimethyl (4-methylsulfanylphenyl) phosphate |
| SMILES | COP(=O)(OC)Oc1ccc(SC)cc1 |
| InChI | InChI=1S/C9H13O4PS/c1-11-14(10,12-2)13-8-4-6-9(15-3)7-5-8/h4-7H,1-3H3 |
| InChIKey | BUDNNLHZOCBLAU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (4-methylsulfanylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (4-methylsulfanylphenyl) phosphate?
The IUPAC name of dimethyl (4-methylsulfanylphenyl) phosphate (CID 18621) is dimethyl (4-methylsulfanylphenyl) phosphate.
What is the SMILES notation for dimethyl (4-methylsulfanylphenyl) phosphate?
The canonical SMILES for dimethyl (4-methylsulfanylphenyl) phosphate is COP(=O)(OC)Oc1ccc(SC)cc1.
What is the InChIKey of dimethyl (4-methylsulfanylphenyl) phosphate?
The InChIKey is BUDNNLHZOCBLAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13O4PS/c1-11-14(10,12-2)13-8-4-6-9(15-3)7-5-8/h4-7H,1-3H3.
What are the key properties of dimethyl (4-methylsulfanylphenyl) phosphate?
dimethyl (4-methylsulfanylphenyl) phosphate has a molecular weight of 248.24 g/mol, XLogP of 3.19, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (4-methylsulfanylphenyl) phosphate is sourced from PubChem (CID 18621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).