C19H26O8P2 — CID 123731391
[4-[2-(4-dimethoxyphosphoryloxyphenyl)propan-2-yl]phenyl] dimethyl phosphate (PubChem CID 123731391) has the molecular formula C19H26O8P2 and a molecular weight of 444.36 g/mol. Its IUPAC name is [4-[2-(4-dimethoxyphosphoryloxyphenyl)propan-2-yl]phenyl] dimethyl phosphate.
| Compound Name | [4-[2-(4-dimethoxyphosphoryloxyphenyl)propan-2-yl]phenyl] dimethyl phosphate |
|---|---|
| PubChem CID | 123731391 |
| Molecular Formula | C19H26O8P2 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [4-[2-(4-dimethoxyphosphoryloxyphenyl)propan-2-yl]phenyl] dimethyl phosphate |
| SMILES | COP(=O)(OC)Oc1ccc(C(C)(C)c2ccc(OP(=O)(OC)OC)cc2)cc1 |
| InChI | InChI=1S/C19H26O8P2/c1-19(2,15-7-11-17(12-8-15)26-28(20,22-3)23-4)16-9-13-18(14-10-16)27-29(21,24-5)25-6/h7-14H,1-6H3 |
| InChIKey | BEGKSZANKBFVSN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|