C54H54N3O7P — CID 91029809
tris[4-[2-[4-(prop-2-enoylamino)phenyl]propan-2-yl]phenyl] phosphate (PubChem CID 91029809) has the molecular formula C54H54N3O7P and a molecular weight of 888.01 g/mol. Its IUPAC name is tris[4-[2-[4-(prop-2-enoylamino)phenyl]propan-2-yl]phenyl] phosphate.
| Compound Name | tris[4-[2-[4-(prop-2-enoylamino)phenyl]propan-2-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 91029809 |
| Molecular Formula | C54H54N3O7P |
| Molecular Weight | 888.01 g/mol |
| Exact Mass | 887.37 |
| IUPAC Name | tris[4-[2-[4-(prop-2-enoylamino)phenyl]propan-2-yl]phenyl] phosphate |
| SMILES | C=CC(=O)Nc1ccc(C(C)(C)c2ccc(OP(=O)(Oc3ccc(C(C)(C)c4ccc(NC(=O)C=C)cc4)cc3)Oc3ccc(C(C)(C)c4ccc(NC(=O)C=C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H54N3O7P/c1-10-49(58)55-43-25-13-37(14-26-43)52(4,5)40-19-31-46(32-20-40)62-65(61,63-47-33-21-41(22-34-47)53(6,7)38-15-27-44(28-16-38)56-50(59)11-2)64-48-35-23-42(24-36-48)54(8,9)39-17-29-45(30-18-39)57-51(60)12-3/h10-36H,1-3H2,4-9H3,(H,55,58)(H,56,59)(H,57,60) |
| InChIKey | CLISUEZIFVAPFH-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 888.01 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|