C27H28O2 — CID 142614427
1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-4-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]propan-2-yl]benzene (PubChem CID 142614427) has the molecular formula C27H28O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-4-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]propan-2-yl]benzene.
| Compound Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-4-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]propan-2-yl]benzene |
|---|---|
| PubChem CID | 142614427 |
| Molecular Formula | C27H28O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-[(3E)-hexa-1,3,5-trien-3-yl]oxy-4-[2-[4-[(3E)-hexa-1,3,5-trien-3-yl]oxyphenyl]propan-2-yl]benzene |
| SMILES | C=C/C=C(\C=C)Oc1ccc(C(C)(C)c2ccc(O/C(C=C)=C/C=C)cc2)cc1 |
| InChI | InChI=1S/C27H28O2/c1-7-11-23(9-3)28-25-17-13-21(14-18-25)27(5,6)22-15-19-26(20-16-22)29-24(10-4)12-8-2/h7-20H,1-4H2,5-6H3/b23-11+,24-12+ |
| InChIKey | CFUYIJZHZHDZSN-ASIDMNOUSA-N |
| XLogP | 7.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|