C12H14O — CID 123811564
1-methyl-4-penta-1,3-dien-3-yloxybenzene (PubChem CID 123811564) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is 1-methyl-4-penta-1,3-dien-3-yloxybenzene.
| Compound Name | 1-methyl-4-penta-1,3-dien-3-yloxybenzene |
|---|---|
| PubChem CID | 123811564 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | 1-methyl-4-penta-1,3-dien-3-yloxybenzene |
| SMILES | C=CC(=CC)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C12H14O/c1-4-11(5-2)13-12-8-6-10(3)7-9-12/h4-9H,1H2,2-3H3 |
| InChIKey | LDFDKVXNBRBGLS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|