C16H18O — CID 142206755
1-methyl-4-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]oxybenzene (PubChem CID 142206755) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-methyl-4-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]oxybenzene.
| Compound Name | 1-methyl-4-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]oxybenzene |
|---|---|
| PubChem CID | 142206755 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-methyl-4-[(2E,4Z)-6-methylocta-2,4-dien-7-yn-3-yl]oxybenzene |
| SMILES | C#CC(C)/C=C\C(=C/C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C16H18O/c1-5-13(3)7-10-15(6-2)17-16-11-8-14(4)9-12-16/h1,6-13H,2-4H3/b10-7-,15-6+ |
| InChIKey | HWCDKBGMRPFNND-RJSHXBOESA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|