C18H18O2 — CID 167082780
1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-phenoxybenzene (PubChem CID 167082780) has the molecular formula C18H18O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-phenoxybenzene.
| Compound Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-phenoxybenzene |
|---|---|
| PubChem CID | 167082780 |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 1-[(2E,4Z)-hexa-2,4-dien-3-yl]oxy-4-phenoxybenzene |
| SMILES | C/C=C\C(=C/C)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C18H18O2/c1-3-8-15(4-2)19-17-11-13-18(14-12-17)20-16-9-6-5-7-10-16/h3-14H,1-2H3/b8-3-,15-4+ |
| InChIKey | MWEOAERYDRIUFZ-KZNFHOQGSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|