C13H14O — CID 142809122
[(3E)-hepta-1,3,5-trien-4-yl]oxybenzene (PubChem CID 142809122) has the molecular formula C13H14O and a molecular weight of 186.25 g/mol. Its IUPAC name is [(3E)-hepta-1,3,5-trien-4-yl]oxybenzene.
| Compound Name | [(3E)-hepta-1,3,5-trien-4-yl]oxybenzene |
|---|---|
| PubChem CID | 142809122 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | [(3E)-hepta-1,3,5-trien-4-yl]oxybenzene |
| SMILES | C=C/C=C(\C=CC)Oc1ccccc1 |
| InChI | InChI=1S/C13H14O/c1-3-8-12(9-4-2)14-13-10-6-5-7-11-13/h3-11H,1H2,2H3/b9-4?,12-8+ |
| InChIKey | RAPGKUBLBFBIEG-FUOPGCFSSA-N |
| XLogP | 3.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|