C21H23O4P — CID 130346897
[(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phenyl phosphate (PubChem CID 130346897) has the molecular formula C21H23O4P and a molecular weight of 370.39 g/mol. Its IUPAC name is [(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phenyl phosphate.
| Compound Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phenyl phosphate |
|---|---|
| PubChem CID | 130346897 |
| Molecular Formula | C21H23O4P |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | [(3E,5Z)-hepta-1,3,5-trien-4-yl] [(3E,5Z)-octa-1,3,5,7-tetraen-4-yl] phenyl phosphate |
| SMILES | C=C/C=C\C(=C/C=C)OP(=O)(OC(/C=C\C)=C/C=C)Oc1ccccc1 |
| InChI | InChI=1S/C21H23O4P/c1-5-9-16-20(15-8-4)24-26(22,23-19(13-6-2)14-7-3)25-21-17-11-10-12-18-21/h5-18H,1-2,4H2,3H3/b14-7-,16-9-,19-13+,20-15+ |
| InChIKey | ATBLAQVDBHZUMA-ZQYCVWIDSA-N |
| XLogP | 6.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|