About triphenyl phosphate;hydrate
triphenyl phosphate;hydrate (PubChem CID 66881958) has the molecular formula C18H17O5P
and a molecular weight of 344.30 g/mol. Its IUPAC name is triphenyl phosphate;hydrate.
Molecular Properties
| Compound Name | triphenyl phosphate;hydrate |
| PubChem CID | 66881958 |
| Molecular Formula | C18H17O5P |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | triphenyl phosphate;hydrate |
| SMILES | O.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H15O4P.H2O/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;/h1-15H;1H2 |
| InChIKey | OPNZLMSKGAKODV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 76.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl phosphate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl phosphate;hydrate?
The IUPAC name of triphenyl phosphate;hydrate (CID 66881958) is triphenyl phosphate;hydrate.
What is the SMILES notation for triphenyl phosphate;hydrate?
The canonical SMILES for triphenyl phosphate;hydrate is O.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of triphenyl phosphate;hydrate?
The InChIKey is OPNZLMSKGAKODV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O4P.H2O/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;/h1-15H;1H2.
What are the key properties of triphenyl phosphate;hydrate?
triphenyl phosphate;hydrate has a molecular weight of 344.30 g/mol, XLogP of 4.51, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl phosphate;hydrate is sourced from PubChem (CID 66881958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).