About dimethyl phenyl phosphate;ethane;trimethyl phosphate
dimethyl phenyl phosphate;ethane;trimethyl phosphate (PubChem CID 90867053) has the molecular formula C13H26O8P2
and a molecular weight of 372.29 g/mol. Its IUPAC name is dimethyl phenyl phosphate;ethane;trimethyl phosphate.
Molecular Properties
| Compound Name | dimethyl phenyl phosphate;ethane;trimethyl phosphate |
| PubChem CID | 90867053 |
| Molecular Formula | C13H26O8P2 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | dimethyl phenyl phosphate;ethane;trimethyl phosphate |
| SMILES | CC.COP(=O)(OC)OC.COP(=O)(OC)Oc1ccccc1 |
| InChI | InChI=1S/C8H11O4P.C3H9O4P.C2H6/c1-10-13(9,11-2)12-8-6-4-3-5-7-8;1-5-8(4,6-2)7-3;1-2/h3-7H,1-2H3;1-3H3;1-2H3 |
| InChIKey | KJJTUFDVUONULT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl phenyl phosphate;ethane;trimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl phenyl phosphate;ethane;trimethyl phosphate?
The IUPAC name of dimethyl phenyl phosphate;ethane;trimethyl phosphate (CID 90867053) is dimethyl phenyl phosphate;ethane;trimethyl phosphate.
What is the SMILES notation for dimethyl phenyl phosphate;ethane;trimethyl phosphate?
The canonical SMILES for dimethyl phenyl phosphate;ethane;trimethyl phosphate is CC.COP(=O)(OC)OC.COP(=O)(OC)Oc1ccccc1.
What is the InChIKey of dimethyl phenyl phosphate;ethane;trimethyl phosphate?
The InChIKey is KJJTUFDVUONULT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O4P.C3H9O4P.C2H6/c1-10-13(9,11-2)12-8-6-4-3-5-7-8;1-5-8(4,6-2)7-3;1-2/h3-7H,1-2H3;1-3H3;1-2H3.
What are the key properties of dimethyl phenyl phosphate;ethane;trimethyl phosphate?
dimethyl phenyl phosphate;ethane;trimethyl phosphate has a molecular weight of 372.29 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl phenyl phosphate;ethane;trimethyl phosphate is sourced from PubChem (CID 90867053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).