About 2-methylpropane;triphenyl phosphate
2-methylpropane;triphenyl phosphate (PubChem CID 91193965) has the molecular formula C22H25O4P
and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-methylpropane;triphenyl phosphate.
Molecular Properties
| Compound Name | 2-methylpropane;triphenyl phosphate |
| PubChem CID | 91193965 |
| Molecular Formula | C22H25O4P |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-methylpropane;triphenyl phosphate |
| SMILES | CC(C)C.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H15O4P.C4H10/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;1-4(2)3/h1-15H;4H,1-3H3 |
| InChIKey | HTFNYMYWNZYCCN-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropane;triphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;triphenyl phosphate?
The IUPAC name of 2-methylpropane;triphenyl phosphate (CID 91193965) is 2-methylpropane;triphenyl phosphate.
What is the SMILES notation for 2-methylpropane;triphenyl phosphate?
The canonical SMILES for 2-methylpropane;triphenyl phosphate is CC(C)C.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 2-methylpropane;triphenyl phosphate?
The InChIKey is HTFNYMYWNZYCCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15O4P.C4H10/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18;1-4(2)3/h1-15H;4H,1-3H3.
What are the key properties of 2-methylpropane;triphenyl phosphate?
2-methylpropane;triphenyl phosphate has a molecular weight of 384.41 g/mol, XLogP of 6.99, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;triphenyl phosphate is sourced from PubChem (CID 91193965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).