About phosphane;toluene;tris(4-methylphenyl) phosphate
phosphane;toluene;tris(4-methylphenyl) phosphate (PubChem CID 174780214) has the molecular formula C28H32O4P2
and a molecular weight of 494.51 g/mol. Its IUPAC name is phosphane;toluene;tris(4-methylphenyl) phosphate.
Molecular Properties
| Compound Name | phosphane;toluene;tris(4-methylphenyl) phosphate |
| PubChem CID | 174780214 |
| Molecular Formula | C28H32O4P2 |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | phosphane;toluene;tris(4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.Cc1ccccc1.P |
| InChI | InChI=1S/C21H21O4P.C7H8.H3P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;1-7-5-3-2-4-6-7;/h4-15H,1-3H3;2-6H,1H3;1H3 |
| InChIKey | XDTGJRSJKVVXHM-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphane;toluene;tris(4-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphane;toluene;tris(4-methylphenyl) phosphate?
The IUPAC name of phosphane;toluene;tris(4-methylphenyl) phosphate (CID 174780214) is phosphane;toluene;tris(4-methylphenyl) phosphate.
What is the SMILES notation for phosphane;toluene;tris(4-methylphenyl) phosphate?
The canonical SMILES for phosphane;toluene;tris(4-methylphenyl) phosphate is Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.Cc1ccccc1.P.
What is the InChIKey of phosphane;toluene;tris(4-methylphenyl) phosphate?
The InChIKey is XDTGJRSJKVVXHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O4P.C7H8.H3P/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;1-7-5-3-2-4-6-7;/h4-15H,1-3H3;2-6H,1H3;1H3.
What are the key properties of phosphane;toluene;tris(4-methylphenyl) phosphate?
phosphane;toluene;tris(4-methylphenyl) phosphate has a molecular weight of 494.51 g/mol, XLogP of 8.31, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phosphane;toluene;tris(4-methylphenyl) phosphate is sourced from PubChem (CID 174780214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).