C35H29O6P — CID 175314566
anthracene-9,10-dione;tris(4-methylphenyl) phosphate (PubChem CID 175314566) has the molecular formula C35H29O6P and a molecular weight of 576.59 g/mol. Its IUPAC name is anthracene-9,10-dione;tris(4-methylphenyl) phosphate.
| Compound Name | anthracene-9,10-dione;tris(4-methylphenyl) phosphate |
|---|---|
| PubChem CID | 175314566 |
| Molecular Formula | C35H29O6P |
| Molecular Weight | 576.59 g/mol |
| Exact Mass | 576.17 |
| IUPAC Name | anthracene-9,10-dione;tris(4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.O=C1c2ccccc2C(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21O4P.C14H8O2/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13/h4-15H,1-3H3;1-8H |
| InChIKey | CJRMFIUVFBDTEF-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.59 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|