About [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate
[2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate (PubChem CID 91534838) has the molecular formula C40H36O8P2
and a molecular weight of 706.67 g/mol. Its IUPAC name is [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate.
Molecular Properties
| Compound Name | [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate |
| PubChem CID | 91534838 |
| Molecular Formula | C40H36O8P2 |
| Molecular Weight | 706.67 g/mol |
| Exact Mass | 706.19 |
| IUPAC Name | [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccccc2-c2ccccc2OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C40H36O8P2/c1-29-13-21-33(22-14-29)43-49(41,44-34-23-15-30(2)16-24-34)47-39-11-7-5-9-37(39)38-10-6-8-12-40(38)48-50(42,45-35-25-17-31(3)18-26-35)46-36-27-19-32(4)20-28-36/h5-28H,1-4H3 |
| InChIKey | PUZOSPPBFWMTDT-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 706.67 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate?
The IUPAC name of [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate (CID 91534838) is [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate.
What is the SMILES notation for [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate?
The canonical SMILES for [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate is Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccccc2-c2ccccc2OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.
What is the InChIKey of [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate?
The InChIKey is PUZOSPPBFWMTDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H36O8P2/c1-29-13-21-33(22-14-29)43-49(41,44-34-23-15-30(2)16-24-34)47-39-11-7-5-9-37(39)38-10-6-8-12-40(38)48-50(42,45-35-25-17-31(3)18-26-35)46-36-27-19-32(4)20-28-36/h5-28H,1-4H3.
What are the key properties of [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate?
[2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate has a molecular weight of 706.67 g/mol, XLogP of 11.88, 13 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-bis(4-methylphenoxy)phosphoryloxyphenyl]phenyl] bis(4-methylphenyl) phosphate is sourced from PubChem (CID 91534838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).