C57H51O12P3 — CID 24832071
(2-methylphenyl) diphenyl phosphate;(3-methylphenyl) diphenyl phosphate;(4-methylphenyl) diphenyl phosphate (PubChem CID 24832071) has the molecular formula C57H51O12P3 and a molecular weight of 1020.95 g/mol. Its IUPAC name is (2-methylphenyl) diphenyl phosphate;(3-methylphenyl) diphenyl phosphate;(4-methylphenyl) diphenyl phosphate.
| Compound Name | (2-methylphenyl) diphenyl phosphate;(3-methylphenyl) diphenyl phosphate;(4-methylphenyl) diphenyl phosphate |
|---|---|
| PubChem CID | 24832071 |
| Molecular Formula | C57H51O12P3 |
| Molecular Weight | 1020.95 g/mol |
| Exact Mass | 1020.26 |
| IUPAC Name | (2-methylphenyl) diphenyl phosphate;(3-methylphenyl) diphenyl phosphate;(4-methylphenyl) diphenyl phosphate |
| SMILES | Cc1ccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)cc1.Cc1cccc(OP(=O)(Oc2ccccc2)Oc2ccccc2)c1.Cc1ccccc1OP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/3C19H17O4P/c1-16-10-8-9-15-19(16)23-24(20,21-17-11-4-2-5-12-17)22-18-13-6-3-7-14-18;1-16-9-8-14-19(15-16)23-24(20,21-17-10-4-2-5-11-17)22-18-12-6-3-7-13-18;1-16-12-14-19(15-13-16)23-24(20,21-17-8-4-2-5-9-17)22-18-10-6-3-7-11-18/h3*2-15H,1H3 |
| InChIKey | GSDOEAIUGYETSW-UHFFFAOYSA-N |
| XLogP | 16.92 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.95 |
| LogP ≤ 5 | 16.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|