About triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate
triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate (PubChem CID 174811049) has the molecular formula C60H57O12P3
and a molecular weight of 1063.03 g/mol. Its IUPAC name is triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate.
Molecular Properties
| Compound Name | triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate |
| PubChem CID | 174811049 |
| Molecular Formula | C60H57O12P3 |
| Molecular Weight | 1063.03 g/mol |
| Exact Mass | 1062.31 |
| IUPAC Name | triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate |
| SMILES | Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc2cccc(C)c2)c1.Cc1ccccc1OP(=O)(Oc1ccccc1C)Oc1ccccc1C.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/2C21H21O4P.C18H15O4P/c1-16-7-4-10-19(13-16)23-26(22,24-20-11-5-8-17(2)14-20)25-21-12-6-9-18(3)15-21;1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3;19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h2*4-15H,1-3H3;1-15H |
| InChIKey | AANYMGNDUGQWAE-UHFFFAOYSA-N |
| XLogP | 17.85 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 75 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1063.03 |
| LogP ≤ 5 | 17.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate?
The IUPAC name of triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate (CID 174811049) is triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate.
What is the SMILES notation for triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate?
The canonical SMILES for triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate is Cc1cccc(OP(=O)(Oc2cccc(C)c2)Oc2cccc(C)c2)c1.Cc1ccccc1OP(=O)(Oc1ccccc1C)Oc1ccccc1C.O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate?
The InChIKey is AANYMGNDUGQWAE-UHFFFAOYSA-N. The full InChI is InChI=1S/2C21H21O4P.C18H15O4P/c1-16-7-4-10-19(13-16)23-26(22,24-20-11-5-8-17(2)14-20)25-21-12-6-9-18(3)15-21;1-16-10-4-7-13-19(16)23-26(22,24-20-14-8-5-11-17(20)2)25-21-15-9-6-12-18(21)3;19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h2*4-15H,1-3H3;1-15H.
What are the key properties of triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate?
triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate has a molecular weight of 1063.03 g/mol, XLogP of 17.85, 18 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for triphenyl phosphate;tris(2-methylphenyl) phosphate;tris(3-methylphenyl) phosphate is sourced from PubChem (CID 174811049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).