About (4-bromophenyl) bis(3-methylphenyl) phosphate
(4-bromophenyl) bis(3-methylphenyl) phosphate (PubChem CID 6426555) has the molecular formula C20H18BrO4P
and a molecular weight of 433.24 g/mol. Its IUPAC name is (4-bromophenyl) bis(3-methylphenyl) phosphate.
Molecular Properties
| Compound Name | (4-bromophenyl) bis(3-methylphenyl) phosphate |
| PubChem CID | 6426555 |
| Molecular Formula | C20H18BrO4P |
| Molecular Weight | 433.24 g/mol |
| Exact Mass | 432.01 |
| IUPAC Name | (4-bromophenyl) bis(3-methylphenyl) phosphate |
| SMILES | Cc1cccc(OP(=O)(Oc2ccc(Br)cc2)Oc2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H18BrO4P/c1-15-5-3-7-19(13-15)24-26(22,23-18-11-9-17(21)10-12-18)25-20-8-4-6-16(2)14-20/h3-14H,1-2H3 |
| InChIKey | BBCZTNQBSQPTNP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.24 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (4-bromophenyl) bis(3-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-bromophenyl) bis(3-methylphenyl) phosphate?
The IUPAC name of (4-bromophenyl) bis(3-methylphenyl) phosphate (CID 6426555) is (4-bromophenyl) bis(3-methylphenyl) phosphate.
What is the SMILES notation for (4-bromophenyl) bis(3-methylphenyl) phosphate?
The canonical SMILES for (4-bromophenyl) bis(3-methylphenyl) phosphate is Cc1cccc(OP(=O)(Oc2ccc(Br)cc2)Oc2cccc(C)c2)c1.
What is the InChIKey of (4-bromophenyl) bis(3-methylphenyl) phosphate?
The InChIKey is BBCZTNQBSQPTNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18BrO4P/c1-15-5-3-7-19(13-15)24-26(22,23-18-11-9-17(21)10-12-18)25-20-8-4-6-16(2)14-20/h3-14H,1-2H3.
What are the key properties of (4-bromophenyl) bis(3-methylphenyl) phosphate?
(4-bromophenyl) bis(3-methylphenyl) phosphate has a molecular weight of 433.24 g/mol, XLogP of 6.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-bromophenyl) bis(3-methylphenyl) phosphate is sourced from PubChem (CID 6426555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).