About (3-bromophenyl) dimethyl phosphate
(3-bromophenyl) dimethyl phosphate (PubChem CID 526167) has the molecular formula C8H10BrO4P
and a molecular weight of 281.04 g/mol. Its IUPAC name is (3-bromophenyl) dimethyl phosphate.
Molecular Properties
| Compound Name | (3-bromophenyl) dimethyl phosphate |
| PubChem CID | 526167 |
| Molecular Formula | C8H10BrO4P |
| Molecular Weight | 281.04 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | (3-bromophenyl) dimethyl phosphate |
| SMILES | COP(=O)(OC)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C8H10BrO4P/c1-11-14(10,12-2)13-8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| InChIKey | JVTOXSUYRIBMHP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.04 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl) dimethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl) dimethyl phosphate?
The IUPAC name of (3-bromophenyl) dimethyl phosphate (CID 526167) is (3-bromophenyl) dimethyl phosphate.
What is the SMILES notation for (3-bromophenyl) dimethyl phosphate?
The canonical SMILES for (3-bromophenyl) dimethyl phosphate is COP(=O)(OC)Oc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl) dimethyl phosphate?
The InChIKey is JVTOXSUYRIBMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrO4P/c1-11-14(10,12-2)13-8-5-3-4-7(9)6-8/h3-6H,1-2H3.
What are the key properties of (3-bromophenyl) dimethyl phosphate?
(3-bromophenyl) dimethyl phosphate has a molecular weight of 281.04 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl) dimethyl phosphate is sourced from PubChem (CID 526167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).