About (3-bromophenyl) formate
(3-bromophenyl) formate (PubChem CID 23207322) has the molecular formula C7H5BrO2
and a molecular weight of 201.02 g/mol. Its IUPAC name is (3-bromophenyl) formate.
Molecular Properties
| Compound Name | (3-bromophenyl) formate |
| PubChem CID | 23207322 |
| Molecular Formula | C7H5BrO2 |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 199.95 |
| IUPAC Name | (3-bromophenyl) formate |
| SMILES | O=COc1cccc(Br)c1 |
| InChI | InChI=1S/C7H5BrO2/c8-6-2-1-3-7(4-6)10-5-9/h1-5H |
| InChIKey | MMJDSHXCSWUGEE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl) formate?
The IUPAC name of (3-bromophenyl) formate (CID 23207322) is (3-bromophenyl) formate.
What is the SMILES notation for (3-bromophenyl) formate?
The canonical SMILES for (3-bromophenyl) formate is O=COc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl) formate?
The InChIKey is MMJDSHXCSWUGEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrO2/c8-6-2-1-3-7(4-6)10-5-9/h1-5H.
What are the key properties of (3-bromophenyl) formate?
(3-bromophenyl) formate has a molecular weight of 201.02 g/mol, XLogP of 1.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl) formate is sourced from PubChem (CID 23207322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).