About (3-bromophenyl) 2-hydroxyacetate
(3-bromophenyl) 2-hydroxyacetate (PubChem CID 130732790) has the molecular formula C8H7BrO3
and a molecular weight of 231.04 g/mol. Its IUPAC name is (3-bromophenyl) 2-hydroxyacetate.
Molecular Properties
| Compound Name | (3-bromophenyl) 2-hydroxyacetate |
| PubChem CID | 130732790 |
| Molecular Formula | C8H7BrO3 |
| Molecular Weight | 231.04 g/mol |
| Exact Mass | 229.96 |
| IUPAC Name | (3-bromophenyl) 2-hydroxyacetate |
| SMILES | O=C(CO)Oc1cccc(Br)c1 |
| InChI | InChI=1S/C8H7BrO3/c9-6-2-1-3-7(4-6)12-8(11)5-10/h1-4,10H,5H2 |
| InChIKey | MUMNKUVTWKBWSP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.04 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl) 2-hydroxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl) 2-hydroxyacetate?
The IUPAC name of (3-bromophenyl) 2-hydroxyacetate (CID 130732790) is (3-bromophenyl) 2-hydroxyacetate.
What is the SMILES notation for (3-bromophenyl) 2-hydroxyacetate?
The canonical SMILES for (3-bromophenyl) 2-hydroxyacetate is O=C(CO)Oc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl) 2-hydroxyacetate?
The InChIKey is MUMNKUVTWKBWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO3/c9-6-2-1-3-7(4-6)12-8(11)5-10/h1-4,10H,5H2.
What are the key properties of (3-bromophenyl) 2-hydroxyacetate?
(3-bromophenyl) 2-hydroxyacetate has a molecular weight of 231.04 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl) 2-hydroxyacetate is sourced from PubChem (CID 130732790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).