About (3-hexanoyloxyphenyl) 3-bromobenzoate
(3-hexanoyloxyphenyl) 3-bromobenzoate (PubChem CID 91728311) has the molecular formula C19H19BrO4
and a molecular weight of 391.26 g/mol. Its IUPAC name is (3-hexanoyloxyphenyl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (3-hexanoyloxyphenyl) 3-bromobenzoate |
| PubChem CID | 91728311 |
| Molecular Formula | C19H19BrO4 |
| Molecular Weight | 391.26 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | (3-hexanoyloxyphenyl) 3-bromobenzoate |
| SMILES | CCCCCC(=O)Oc1cccc(OC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C19H19BrO4/c1-2-3-4-11-18(21)23-16-9-6-10-17(13-16)24-19(22)14-7-5-8-15(20)12-14/h5-10,12-13H,2-4,11H2,1H3 |
| InChIKey | HONOUSKDLVGAHV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.26 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-hexanoyloxyphenyl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hexanoyloxyphenyl) 3-bromobenzoate?
The IUPAC name of (3-hexanoyloxyphenyl) 3-bromobenzoate (CID 91728311) is (3-hexanoyloxyphenyl) 3-bromobenzoate.
What is the SMILES notation for (3-hexanoyloxyphenyl) 3-bromobenzoate?
The canonical SMILES for (3-hexanoyloxyphenyl) 3-bromobenzoate is CCCCCC(=O)Oc1cccc(OC(=O)c2cccc(Br)c2)c1.
What is the InChIKey of (3-hexanoyloxyphenyl) 3-bromobenzoate?
The InChIKey is HONOUSKDLVGAHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19BrO4/c1-2-3-4-11-18(21)23-16-9-6-10-17(13-16)24-19(22)14-7-5-8-15(20)12-14/h5-10,12-13H,2-4,11H2,1H3.
What are the key properties of (3-hexanoyloxyphenyl) 3-bromobenzoate?
(3-hexanoyloxyphenyl) 3-bromobenzoate has a molecular weight of 391.26 g/mol, XLogP of 5.15, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hexanoyloxyphenyl) 3-bromobenzoate is sourced from PubChem (CID 91728311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).