C29H33BrO7 — CID 23038865
(2,3,7-triethoxy-4-hexanoyloxynaphthalen-1-yl) 3-bromobenzoate (PubChem CID 23038865) has the molecular formula C29H33BrO7 and a molecular weight of 573.48 g/mol. Its IUPAC name is (2,3,7-triethoxy-4-hexanoyloxynaphthalen-1-yl) 3-bromobenzoate.
| Compound Name | (2,3,7-triethoxy-4-hexanoyloxynaphthalen-1-yl) 3-bromobenzoate |
|---|---|
| PubChem CID | 23038865 |
| Molecular Formula | C29H33BrO7 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | (2,3,7-triethoxy-4-hexanoyloxynaphthalen-1-yl) 3-bromobenzoate |
| SMILES | CCCCCC(=O)Oc1c(OCC)c(OCC)c(OC(=O)c2cccc(Br)c2)c2cc(OCC)ccc12 |
| InChI | InChI=1S/C29H33BrO7/c1-5-9-10-14-24(31)36-25-22-16-15-21(33-6-2)18-23(22)26(28(35-8-4)27(25)34-7-3)37-29(32)19-12-11-13-20(30)17-19/h11-13,15-18H,5-10,14H2,1-4H3 |
| InChIKey | HXJZHXGMIAKWLU-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|