C34H46O4 — CID 135239615
(2,3-dimethyl-10-nonanoyloxyanthracen-9-yl) nonanoate (PubChem CID 135239615) has the molecular formula C34H46O4 and a molecular weight of 518.74 g/mol. Its IUPAC name is (2,3-dimethyl-10-nonanoyloxyanthracen-9-yl) nonanoate.
| Compound Name | (2,3-dimethyl-10-nonanoyloxyanthracen-9-yl) nonanoate |
|---|---|
| PubChem CID | 135239615 |
| Molecular Formula | C34H46O4 |
| Molecular Weight | 518.74 g/mol |
| Exact Mass | 518.34 |
| IUPAC Name | (2,3-dimethyl-10-nonanoyloxyanthracen-9-yl) nonanoate |
| SMILES | CCCCCCCCC(=O)Oc1c2ccccc2c(OC(=O)CCCCCCCC)c2cc(C)c(C)cc12 |
| InChI | InChI=1S/C34H46O4/c1-5-7-9-11-13-15-21-31(35)37-33-27-19-17-18-20-28(27)34(30-24-26(4)25(3)23-29(30)33)38-32(36)22-16-14-12-10-8-6-2/h17-20,23-24H,5-16,21-22H2,1-4H3 |
| InChIKey | WBEBZYCLWZUALJ-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.74 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|