C36H50O4 — CID 172716273
(10-decanoyloxy-3,4-dimethylanthracen-9-yl) decanoate (PubChem CID 172716273) has the molecular formula C36H50O4 and a molecular weight of 546.79 g/mol. Its IUPAC name is (10-decanoyloxy-3,4-dimethylanthracen-9-yl) decanoate.
| Compound Name | (10-decanoyloxy-3,4-dimethylanthracen-9-yl) decanoate |
|---|---|
| PubChem CID | 172716273 |
| Molecular Formula | C36H50O4 |
| Molecular Weight | 546.79 g/mol |
| Exact Mass | 546.37 |
| IUPAC Name | (10-decanoyloxy-3,4-dimethylanthracen-9-yl) decanoate |
| SMILES | CCCCCCCCCC(=O)Oc1c2ccccc2c(OC(=O)CCCCCCCCC)c2c(C)c(C)ccc12 |
| InChI | InChI=1S/C36H50O4/c1-5-7-9-11-13-15-17-23-32(37)39-35-29-21-19-20-22-30(29)36(34-28(4)27(3)25-26-31(34)35)40-33(38)24-18-16-14-12-10-8-6-2/h19-22,25-26H,5-18,23-24H2,1-4H3 |
| InChIKey | FXCRCLVWTPYVFL-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.79 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|