C26H29O2S+ — CID 158522075
(4-hexanoyloxy-3,5-dimethylphenyl)-diphenylsulfanium (PubChem CID 158522075) has the molecular formula C26H29O2S+ and a molecular weight of 405.58 g/mol. Its IUPAC name is (4-hexanoyloxy-3,5-dimethylphenyl)-diphenylsulfanium.
| Compound Name | (4-hexanoyloxy-3,5-dimethylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 158522075 |
| Molecular Formula | C26H29O2S+ |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | (4-hexanoyloxy-3,5-dimethylphenyl)-diphenylsulfanium |
| SMILES | CCCCCC(=O)Oc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C26H29O2S/c1-4-5-8-17-25(27)28-26-20(2)18-24(19-21(26)3)29(22-13-9-6-10-14-22)23-15-11-7-12-16-23/h6-7,9-16,18-19H,4-5,8,17H2,1-3H3/q+1 |
| InChIKey | GQYSDXGMTRAOJF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|