C26H27O4S+ — CID 59435129
[4-(4-ethoxy-4-oxobutanoyl)oxy-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 59435129) has the molecular formula C26H27O4S+ and a molecular weight of 435.57 g/mol. Its IUPAC name is [4-(4-ethoxy-4-oxobutanoyl)oxy-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-(4-ethoxy-4-oxobutanoyl)oxy-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 59435129 |
| Molecular Formula | C26H27O4S+ |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | [4-(4-ethoxy-4-oxobutanoyl)oxy-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | CCOC(=O)CCC(=O)Oc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C26H27O4S/c1-4-29-24(27)15-16-25(28)30-26-19(2)17-23(18-20(26)3)31(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-14,17-18H,4,15-16H2,1-3H3/q+1 |
| InChIKey | KSIUBASDFUVCOW-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|