C25H25O2S+ — CID 171591123
[3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium (PubChem CID 171591123) has the molecular formula C25H25O2S+ and a molecular weight of 389.54 g/mol. Its IUPAC name is [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171591123 |
| Molecular Formula | C25H25O2S+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium |
| SMILES | CC(C)=CC(=O)Oc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C25H25O2S/c1-18(2)15-24(26)27-25-19(3)16-23(17-20(25)4)28(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-17H,1-4H3/q+1 |
| InChIKey | VYZPBNLEOVSRSE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|