About [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium
[3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium (PubChem CID 171591123) has the molecular formula C25H25O2S+
and a molecular weight of 389.54 g/mol. Its IUPAC name is [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium.
Molecular Properties
| Compound Name | [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium |
| PubChem CID | 171591123 |
| Molecular Formula | C25H25O2S+ |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium |
| SMILES | CC(C)=CC(=O)Oc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C25H25O2S/c1-18(2)15-24(26)27-25-19(3)16-23(17-20(25)4)28(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-17H,1-4H3/q+1 |
| InChIKey | VYZPBNLEOVSRSE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium?
The IUPAC name of [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium (CID 171591123) is [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium.
What is the SMILES notation for [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium?
The canonical SMILES for [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium is CC(C)=CC(=O)Oc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C.
What is the InChIKey of [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium?
The InChIKey is VYZPBNLEOVSRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25O2S/c1-18(2)15-24(26)27-25-19(3)16-23(17-20(25)4)28(21-11-7-5-8-12-21)22-13-9-6-10-14-22/h5-17H,1-4H3/q+1.
What are the key properties of [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium?
[3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium has a molecular weight of 389.54 g/mol, XLogP of 6.27, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dimethyl-4-(3-methylbut-2-enoyloxy)phenyl]-diphenylsulfanium is sourced from PubChem (CID 171591123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).