C22H23O2S+ — CID 164717649
[4-(methoxymethoxy)-3,5-dimethylphenyl]-diphenylsulfanium (PubChem CID 164717649) has the molecular formula C22H23O2S+ and a molecular weight of 351.49 g/mol. Its IUPAC name is [4-(methoxymethoxy)-3,5-dimethylphenyl]-diphenylsulfanium.
| Compound Name | [4-(methoxymethoxy)-3,5-dimethylphenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 164717649 |
| Molecular Formula | C22H23O2S+ |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | [4-(methoxymethoxy)-3,5-dimethylphenyl]-diphenylsulfanium |
| SMILES | COCOc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C22H23O2S/c1-17-14-21(15-18(2)22(17)24-16-23-3)25(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-15H,16H2,1-3H3/q+1 |
| InChIKey | WZCLRSXLQNZGIJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|