C20H19BrOS — CID 165110171
(4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium bromide (PubChem CID 165110171) has the molecular formula C20H19BrOS and a molecular weight of 387.34 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium bromide.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium bromide |
|---|---|
| PubChem CID | 165110171 |
| Molecular Formula | C20H19BrOS |
| Molecular Weight | 387.34 g/mol |
| Exact Mass | 386.03 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium bromide |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1O.[Br-] |
| InChI | InChI=1S/C20H18OS.BrH/c1-15-13-19(14-16(2)20(15)21)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18;/h3-14H,1-2H3;1H |
| InChIKey | ZUTWYQUZPSDXQH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|