C26H30O2S — CID 162307446
phenyl-bis(2,4,6-trimethylphenyl)sulfanium acetate (PubChem CID 162307446) has the molecular formula C26H30O2S and a molecular weight of 406.59 g/mol. Its IUPAC name is phenyl-bis(2,4,6-trimethylphenyl)sulfanium acetate.
| Compound Name | phenyl-bis(2,4,6-trimethylphenyl)sulfanium acetate |
|---|---|
| PubChem CID | 162307446 |
| Molecular Formula | C26H30O2S |
| Molecular Weight | 406.59 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | phenyl-bis(2,4,6-trimethylphenyl)sulfanium acetate |
| SMILES | CC(=O)[O-].Cc1cc(C)c([S+](c2ccccc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C24H27S.C2H4O2/c1-16-12-18(3)23(19(4)13-16)25(22-10-8-7-9-11-22)24-20(5)14-17(2)15-21(24)6;1-2(3)4/h7-15H,1-6H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | VZKMONPRGBYWJX-UHFFFAOYSA-M |
| XLogP | 5.39 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|