C21H21F6SSb — CID 23133103
diphenyl-(2,4,6-trimethylphenyl)sulfanium;hexafluoroantimony(1-) (PubChem CID 23133103) has the molecular formula C21H21F6SSb and a molecular weight of 541.21 g/mol. Its IUPAC name is diphenyl-(2,4,6-trimethylphenyl)sulfanium;hexafluoroantimony(1-).
| Compound Name | diphenyl-(2,4,6-trimethylphenyl)sulfanium;hexafluoroantimony(1-) |
|---|---|
| PubChem CID | 23133103 |
| Molecular Formula | C21H21F6SSb |
| Molecular Weight | 541.21 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | diphenyl-(2,4,6-trimethylphenyl)sulfanium;hexafluoroantimony(1-) |
| SMILES | Cc1cc(C)c([S+](c2ccccc2)c2ccccc2)c(C)c1.F[Sb-](F)(F)(F)(F)F |
| InChI | InChI=1S/C21H21S.6FH.Sb/c1-16-14-17(2)21(18(3)15-16)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20;;;;;;;/h4-15H,1-3H3;6*1H;/q+1;;;;;;;+5/p-6 |
| InChIKey | VFNIICXWQFZWBH-UHFFFAOYSA-H |
| XLogP | 7.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.21 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|