C21H15F6S+ — CID 158764724
[2-methyl-4,6-bis(trifluoromethyl)phenyl]-diphenylsulfanium (PubChem CID 158764724) has the molecular formula C21H15F6S+ and a molecular weight of 413.41 g/mol. Its IUPAC name is [2-methyl-4,6-bis(trifluoromethyl)phenyl]-diphenylsulfanium.
| Compound Name | [2-methyl-4,6-bis(trifluoromethyl)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 158764724 |
| Molecular Formula | C21H15F6S+ |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-methyl-4,6-bis(trifluoromethyl)phenyl]-diphenylsulfanium |
| SMILES | Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H15F6S/c1-14-12-15(20(22,23)24)13-18(21(25,26)27)19(14)28(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13H,1H3/q+1 |
| InChIKey | HHOFKOXNWOCHEF-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|