C21H18F3S+ — CID 58205732
[3,5-dimethyl-4-(trifluoromethyl)phenyl]-diphenylsulfanium (PubChem CID 58205732) has the molecular formula C21H18F3S+ and a molecular weight of 359.44 g/mol. Its IUPAC name is [3,5-dimethyl-4-(trifluoromethyl)phenyl]-diphenylsulfanium.
| Compound Name | [3,5-dimethyl-4-(trifluoromethyl)phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 58205732 |
| Molecular Formula | C21H18F3S+ |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | [3,5-dimethyl-4-(trifluoromethyl)phenyl]-diphenylsulfanium |
| SMILES | Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1C(F)(F)F |
| InChI | InChI=1S/C21H18F3S/c1-15-13-19(14-16(2)20(15)21(22,23)24)25(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-14H,1-2H3/q+1 |
| InChIKey | QXQIDZIFSMEUFH-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|