C24H27S+ — CID 58205684
(4-butyl-3,5-dimethylphenyl)-diphenylsulfanium (PubChem CID 58205684) has the molecular formula C24H27S+ and a molecular weight of 347.55 g/mol. Its IUPAC name is (4-butyl-3,5-dimethylphenyl)-diphenylsulfanium.
| Compound Name | (4-butyl-3,5-dimethylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 58205684 |
| Molecular Formula | C24H27S+ |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (4-butyl-3,5-dimethylphenyl)-diphenylsulfanium |
| SMILES | CCCCc1c(C)cc([S+](c2ccccc2)c2ccccc2)cc1C |
| InChI | InChI=1S/C24H27S/c1-4-5-16-24-19(2)17-23(18-20(24)3)25(21-12-8-6-9-13-21)22-14-10-7-11-15-22/h6-15,17-18H,4-5,16H2,1-3H3/q+1 |
| InChIKey | SDXBQDGGCMUGNO-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|