C22H23S+ — CID 22057384
bis(2,6-dimethylphenyl)-phenylsulfanium (PubChem CID 22057384) has the molecular formula C22H23S+ and a molecular weight of 319.49 g/mol. Its IUPAC name is bis(2,6-dimethylphenyl)-phenylsulfanium.
| Compound Name | bis(2,6-dimethylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 22057384 |
| Molecular Formula | C22H23S+ |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | bis(2,6-dimethylphenyl)-phenylsulfanium |
| SMILES | Cc1cccc(C)c1[S+](c1ccccc1)c1c(C)cccc1C |
| InChI | InChI=1S/C22H23S/c1-16-10-8-11-17(2)21(16)23(20-14-6-5-7-15-20)22-18(3)12-9-13-19(22)4/h5-15H,1-4H3/q+1 |
| InChIKey | SDMXKOAIBFWYQP-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|