C19H17AsF6S — CID 23133107
hexafluoroarsenic(1-);(2-methylphenyl)-diphenylsulfanium (PubChem CID 23133107) has the molecular formula C19H17AsF6S and a molecular weight of 466.32 g/mol. Its IUPAC name is hexafluoroarsenic(1-);(2-methylphenyl)-diphenylsulfanium.
| Compound Name | hexafluoroarsenic(1-);(2-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 23133107 |
| Molecular Formula | C19H17AsF6S |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.02 |
| IUPAC Name | hexafluoroarsenic(1-);(2-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccccc1[S+](c1ccccc1)c1ccccc1.F[As-](F)(F)(F)(F)F |
| InChI | InChI=1S/C19H17S.AsF6/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;2-1(3,4,5,6)7/h2-15H,1H3;/q+1;-1 |
| InChIKey | DCUNMOPQIAKAJK-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|