C21H21OS+ — CID 151044563
(2,3-dimethylphenyl)-(4-methoxyphenyl)-phenylsulfanium (PubChem CID 151044563) has the molecular formula C21H21OS+ and a molecular weight of 321.47 g/mol. Its IUPAC name is (2,3-dimethylphenyl)-(4-methoxyphenyl)-phenylsulfanium.
| Compound Name | (2,3-dimethylphenyl)-(4-methoxyphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 151044563 |
| Molecular Formula | C21H21OS+ |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (2,3-dimethylphenyl)-(4-methoxyphenyl)-phenylsulfanium |
| SMILES | COc1ccc([S+](c2ccccc2)c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C21H21OS/c1-16-8-7-11-21(17(16)2)23(19-9-5-4-6-10-19)20-14-12-18(22-3)13-15-20/h4-15H,1-3H3/q+1 |
| InChIKey | MCUKUWUAJUPNBW-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|