C19H16FS+ — CID 59733796
(4-fluorophenyl)-(2-methylphenyl)-phenylsulfanium (PubChem CID 59733796) has the molecular formula C19H16FS+ and a molecular weight of 295.40 g/mol. Its IUPAC name is (4-fluorophenyl)-(2-methylphenyl)-phenylsulfanium.
| Compound Name | (4-fluorophenyl)-(2-methylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 59733796 |
| Molecular Formula | C19H16FS+ |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (4-fluorophenyl)-(2-methylphenyl)-phenylsulfanium |
| SMILES | Cc1ccccc1[S+](c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16FS/c1-15-7-5-6-10-19(15)21(17-8-3-2-4-9-17)18-13-11-16(20)12-14-18/h2-14H,1H3/q+1 |
| InChIKey | RHTUGYKWZFVNQZ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|