C26H17F15O6S4 — CID 159160360
1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane;(2-methylphenyl)-diphenylsulfanium (PubChem CID 159160360) has the molecular formula C26H17F15O6S4 and a molecular weight of 838.65 g/mol. Its IUPAC name is 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane;(2-methylphenyl)-diphenylsulfanium.
| Compound Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane;(2-methylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 159160360 |
| Molecular Formula | C26H17F15O6S4 |
| Molecular Weight | 838.65 g/mol |
| Exact Mass | 837.97 |
| IUPAC Name | 1-[bis(1,1,2,2,2-pentafluoroethylsulfonyl)methylsulfonyl]-1,1,2,2,2-pentafluoroethane;(2-methylphenyl)-diphenylsulfanium |
| SMILES | Cc1ccccc1[S+](c1ccccc1)c1ccccc1.O=S(=O)([C-](S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H17S.C7F15O6S3/c1-16-10-8-9-15-19(16)20(17-11-4-2-5-12-17)18-13-6-3-7-14-18;8-2(9,10)5(17,18)29(23,24)1(30(25,26)6(19,20)3(11,12)13)31(27,28)7(21,22)4(14,15)16/h2-15H,1H3;/q+1;-1 |
| InChIKey | KKKHYBBVXROFEO-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.65 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|