C24H22F6O4S2 — CID 157388254
1,1,2,2,3,3-hexafluorobutane-1-sulfonate;(4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium (PubChem CID 157388254) has the molecular formula C24H22F6O4S2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;(4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium.
| Compound Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;(4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 157388254 |
| Molecular Formula | C24H22F6O4S2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.09 |
| IUPAC Name | 1,1,2,2,3,3-hexafluorobutane-1-sulfonate;(4-hydroxy-3,5-dimethylphenyl)-diphenylsulfanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].Cc1cc([S+](c2ccccc2)c2ccccc2)cc(C)c1O |
| InChI | InChI=1S/C20H18OS.C4H4F6O3S/c1-15-13-19(14-16(2)20(15)21)22(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-2(5,6)3(7,8)4(9,10)14(11,12)13/h3-14H,1-2H3;1H3,(H,11,12,13) |
| InChIKey | BLROUPRLKOFAAU-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|