C40H30F8O6S4 — CID 87079447
1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfonate;bis(triphenylsulfanium) (PubChem CID 87079447) has the molecular formula C40H30F8O6S4 and a molecular weight of 886.93 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfonate;bis(triphenylsulfanium).
| Compound Name | 1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfonate;bis(triphenylsulfanium) |
|---|---|
| PubChem CID | 87079447 |
| Molecular Formula | C40H30F8O6S4 |
| Molecular Weight | 886.93 g/mol |
| Exact Mass | 886.08 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluorobutane-1,4-disulfonate;bis(triphenylsulfanium) |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H15S.C4H2F8O6S2/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;5-1(6,3(9,10)19(13,14)15)2(7,8)4(11,12)20(16,17)18/h2*1-15H;(H,13,14,15)(H,16,17,18)/q2*+1;/p-2 |
| InChIKey | XJBPQWIEEYNCPW-UHFFFAOYSA-L |
| XLogP | 10.10 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 886.93 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|