C22H15F9O6S2 — CID 22023915
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hydroxyphenyl)sulfanium (PubChem CID 22023915) has the molecular formula C22H15F9O6S2 and a molecular weight of 610.47 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hydroxyphenyl)sulfanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hydroxyphenyl)sulfanium |
|---|---|
| PubChem CID | 22023915 |
| Molecular Formula | C22H15F9O6S2 |
| Molecular Weight | 610.47 g/mol |
| Exact Mass | 610.02 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;tris(4-hydroxyphenyl)sulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.Oc1ccc([S+](c2ccc(O)cc2)c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C18H14O3S.C4HF9O3S/c19-13-1-7-16(8-2-13)22(17-9-3-14(20)4-10-17)18-11-5-15(21)6-12-18;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-12H,(H2-,19,20,21);(H,14,15,16) |
| InChIKey | JLVSJTRIURFPMI-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|