About bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium
bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium (PubChem CID 139203165) has the molecular formula C20H15F6NO4S3
and a molecular weight of 543.53 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium.
Molecular Properties
| Compound Name | bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium |
| PubChem CID | 139203165 |
| Molecular Formula | C20H15F6NO4S3 |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium |
| SMILES | O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C2F6NO4S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-15H;/q+1;-1 |
| InChIKey | ZLJHCPCYKYJGGL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium?
The IUPAC name of bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium (CID 139203165) is bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium.
What is the SMILES notation for bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium?
The canonical SMILES for bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium is O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium?
The InChIKey is ZLJHCPCYKYJGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15S.C2F6NO4S2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h1-15H;/q+1;-1.
What are the key properties of bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium?
bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium has a molecular weight of 543.53 g/mol, XLogP of 5.84, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(trifluoromethylsulfonyl)azanide;triphenylsulfanium is sourced from PubChem (CID 139203165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).